4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid

C15H19N3O2 — CID 65347777

IUPAC4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid
SMILESCc1c(C(C)NCc2ccc(C(=O)O)cc2)cnn1C
InChIInChI=1S/C15H19N3O2/c1-10(14-9-17-18(3)11(14)2)16-8-12-4-6-13(7-5-12)15(19)20/h4-7,9-10,16H,8H2,1-3H3,(H,19,20)
InChIKeyGHZDKQRIZITJFM-UHFFFAOYSA-N
MW273.34 g/mol
LogP2.28
Rot. Bonds5

About 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid

4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid (PubChem CID 65347777) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid.

Molecular Properties

Compound Name4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid
PubChem CID65347777
Molecular FormulaC15H19N3O2
Molecular Weight273.34 g/mol
Exact Mass273.15
IUPAC Name4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid
SMILESCc1c(C(C)NCc2ccc(C(=O)O)cc2)cnn1C
InChIInChI=1S/C15H19N3O2/c1-10(14-9-17-18(3)11(14)2)16-8-12-4-6-13(7-5-12)15(19)20/h4-7,9-10,16H,8H2,1-3H3,(H,19,20)
InChIKeyGHZDKQRIZITJFM-UHFFFAOYSA-N
XLogP2.28
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.34
LogP ≤ 52.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid?
The IUPAC name of 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid (CID 65347777) is 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid.
What is the SMILES notation for 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid?
The canonical SMILES for 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid is Cc1c(C(C)NCc2ccc(C(=O)O)cc2)cnn1C.
What is the InChIKey of 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid?
The InChIKey is GHZDKQRIZITJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-10(14-9-17-18(3)11(14)2)16-8-12-4-6-13(7-5-12)15(19)20/h4-7,9-10,16H,8H2,1-3H3,(H,19,20).
What are the key properties of 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid?
4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid has a molecular weight of 273.34 g/mol, XLogP of 2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(1,5-dimethylpyrazol-4-yl)ethylamino]methyl]benzoic acid is sourced from PubChem (CID 65347777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).