C15H19NO2S — CID 43432460
4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzene-1,2-diol (PubChem CID 43432460) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43432460 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzene-1,2-diol |
| SMILES | Cc1cc(C(C)NCc2ccc(O)c(O)c2)c(C)s1 |
| InChI | InChI=1S/C15H19NO2S/c1-9-6-13(11(3)19-9)10(2)16-8-12-4-5-14(17)15(18)7-12/h4-7,10,16-18H,8H2,1-3H3 |
| InChIKey | MFOKWTGQQQUTQH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|