About N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide (PubChem CID 54973764) has the molecular formula C11H20N2O2S2
and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide.
Molecular Properties
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide |
| PubChem CID | 54973764 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)NC(C)c1cc(C)sc1C |
| InChI | InChI=1S/C11H20N2O2S2/c1-8-7-11(10(3)16-8)9(2)13-17(14,15)6-5-12-4/h7,9,12-13H,5-6H2,1-4H3 |
| InChIKey | GWVZGQFTZHXRBY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide?
The IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide (CID 54973764) is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide.
What is the SMILES notation for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide?
The canonical SMILES for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide is CNCCS(=O)(=O)NC(C)c1cc(C)sc1C.
What is the InChIKey of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide?
The InChIKey is GWVZGQFTZHXRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2S2/c1-8-7-11(10(3)16-8)9(2)13-17(14,15)6-5-12-4/h7,9,12-13H,5-6H2,1-4H3.
What are the key properties of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide?
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide has a molecular weight of 276.43 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)ethanesulfonamide is sourced from PubChem (CID 54973764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).