C13H20BrNOS — CID 107908544
5-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]pentanamide (PubChem CID 107908544) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is 5-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]pentanamide.
| Compound Name | 5-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 107908544 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-bromo-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]pentanamide |
| SMILES | Cc1cc(C(C)NC(=O)CCCCBr)c(C)s1 |
| InChI | InChI=1S/C13H20BrNOS/c1-9-8-12(11(3)17-9)10(2)15-13(16)6-4-5-7-14/h8,10H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | ABDXMZBOGWQHKU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|