C16H21NOS — CID 62867709
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxy-2-methylaniline (PubChem CID 62867709) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxy-2-methylaniline.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxy-2-methylaniline |
|---|---|
| PubChem CID | 62867709 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-methoxy-2-methylaniline |
| SMILES | COc1ccc(NC(C)c2cc(C)sc2C)c(C)c1 |
| InChI | InChI=1S/C16H21NOS/c1-10-8-14(18-5)6-7-16(10)17-12(3)15-9-11(2)19-13(15)4/h6-9,12,17H,1-5H3 |
| InChIKey | HWUGGLOTSOYLJN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|