C22H31ClN2O2 — CID 32689439
N-[(2S)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide (PubChem CID 32689439) has the molecular formula C22H31ClN2O2 and a molecular weight of 390.96 g/mol. Its IUPAC name is N-[(2S)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide.
| Compound Name | N-[(2S)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 32689439 |
| Molecular Formula | C22H31ClN2O2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[(2S)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-2-chlorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1Cl)C(=O)N[C@@H]1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C22H31ClN2O2/c1-14(2)20(25-21(26)18-9-5-6-10-19(18)23)22(27)24-17-12-11-15-7-3-4-8-16(15)13-17/h5-6,9-10,14-17,20H,3-4,7-8,11-13H2,1-2H3,(H,24,27)(H,25,26)/t15-,16-,17-,20+/m1/s1 |
| InChIKey | IKJQCLLYSPWOGO-VIPLHTEESA-N |
| XLogP | 4.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |