C12H13ClNO3- — CID 1248820
(2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 1248820) has the molecular formula C12H13ClNO3- and a molecular weight of 254.69 g/mol. Its IUPAC name is (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 1248820 |
| Molecular Formula | C12H13ClNO3- |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C12H14ClNO3/c1-7(2)10(12(16)17)14-11(15)8-5-3-4-6-9(8)13/h3-7,10H,1-2H3,(H,14,15)(H,16,17)/p-1/t10-/m0/s1 |
| InChIKey | ATYBZNXCZXTMOA-JTQLQIEISA-M |
| XLogP | 0.84 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |