C19H26ClN3O4 — CID 2549179
2-chloro-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide (PubChem CID 2549179) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 2549179 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-chloro-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]-5-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cc([N+](=O)[O-])ccc1Cl)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H26ClN3O4/c1-12(2)17(19(25)21-13-7-5-3-4-6-8-13)22-18(24)15-11-14(23(26)27)9-10-16(15)20/h9-13,17H,3-8H2,1-2H3,(H,21,25)(H,22,24)/t17-/m0/s1 |
| InChIKey | KBBXIZUOFRQYDW-KRWDZBQOSA-N |
| XLogP | 3.84 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|