C22H24ClN3O4 — CID 167743703
2-chloro-N-[3-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]-1-oxobutan-2-yl]-5-nitrobenzamide (PubChem CID 167743703) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]-1-oxobutan-2-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]-1-oxobutan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 167743703 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]-1-oxobutan-2-yl]-5-nitrobenzamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)C(NC(=O)c1cc([N+](=O)[O-])ccc1Cl)C(C)C)CC2 |
| InChI | InChI=1S/C22H24ClN3O4/c1-12(2)20(25-21(27)17-11-15(26(29)30)7-8-18(17)23)22(28)24-19-9-6-14-5-4-13(3)10-16(14)19/h4-5,7-8,10-12,19-20H,6,9H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | ZDIBNPUWWDZCNY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|