C26H33N3O3 — CID 41011047
2-benzamido-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 41011047) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-benzamido-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-benzamido-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 41011047 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-benzamido-N-[(2S)-1-(cycloheptylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1NC(=O)c1ccccc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C26H33N3O3/c1-18(2)23(26(32)27-20-14-8-3-4-9-15-20)29-25(31)21-16-10-11-17-22(21)28-24(30)19-12-6-5-7-13-19/h5-7,10-13,16-18,20,23H,3-4,8-9,14-15H2,1-2H3,(H,27,32)(H,28,30)(H,29,31)/t23-/m0/s1 |
| InChIKey | LVQLHUNXBWLWKM-QHCPKHFHSA-N |
| XLogP | 4.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |