C20H27ClN2O4 — CID 46603286
methyl 1-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]cyclohexane-1-carboxylate (PubChem CID 46603286) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is methyl 1-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46603286 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | methyl 1-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)C(NC(=O)c2ccccc2Cl)C(C)C)CCCCC1 |
| InChI | InChI=1S/C20H27ClN2O4/c1-13(2)16(22-17(24)14-9-5-6-10-15(14)21)18(25)23-20(19(26)27-3)11-7-4-8-12-20/h5-6,9-10,13,16H,4,7-8,11-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | WKCVGDDRNMIKTO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |