C16H18F3NO3S — CID 39118078
methyl 1-[[2-(trifluoromethylsulfanyl)benzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 39118078) has the molecular formula C16H18F3NO3S and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl 1-[[2-(trifluoromethylsulfanyl)benzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[2-(trifluoromethylsulfanyl)benzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 39118078 |
| Molecular Formula | C16H18F3NO3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 1-[[2-(trifluoromethylsulfanyl)benzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccccc2SC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C16H18F3NO3S/c1-23-14(22)15(9-5-2-6-10-15)20-13(21)11-7-3-4-8-12(11)24-16(17,18)19/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,20,21) |
| InChIKey | LPYCGLULRSOJGQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |