C23H27NO4 — CID 10385185
3-methoxy-N-[1-(2-methoxybenzoyl)cyclohexyl]-2-methylbenzamide (PubChem CID 10385185) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-methoxy-N-[1-(2-methoxybenzoyl)cyclohexyl]-2-methylbenzamide.
| Compound Name | 3-methoxy-N-[1-(2-methoxybenzoyl)cyclohexyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 10385185 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-methoxy-N-[1-(2-methoxybenzoyl)cyclohexyl]-2-methylbenzamide |
| SMILES | COc1ccccc1C(=O)C1(NC(=O)c2cccc(OC)c2C)CCCCC1 |
| InChI | InChI=1S/C23H27NO4/c1-16-17(11-9-13-19(16)27-2)22(26)24-23(14-7-4-8-15-23)21(25)18-10-5-6-12-20(18)28-3/h5-6,9-13H,4,7-8,14-15H2,1-3H3,(H,24,26) |
| InChIKey | HLWLRCRKQGQDSK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |