About tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate
tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 59713394) has the molecular formula C28H36N2O5
and a molecular weight of 480.61 g/mol. Its IUPAC name is tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate |
| PubChem CID | 59713394 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | COc1cccc(C(=O)NC2(C(=O)c3cc(C)cc(C)c3)CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C28H36N2O5/c1-18-15-19(2)17-21(16-18)24(31)28(11-13-30(14-12-28)26(33)35-27(4,5)6)29-25(32)22-9-8-10-23(34-7)20(22)3/h8-10,15-17H,11-14H2,1-7H3,(H,29,32) |
| InChIKey | MRYTWZJMYKPILJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate (CID 59713394) is tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate is COc1cccc(C(=O)NC2(C(=O)c3cc(C)cc(C)c3)CCN(C(=O)OC(C)(C)C)CC2)c1C.
What is the InChIKey of tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate?
The InChIKey is MRYTWZJMYKPILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36N2O5/c1-18-15-19(2)17-21(16-18)24(31)28(11-13-30(14-12-28)26(33)35-27(4,5)6)29-25(32)22-9-8-10-23(34-7)20(22)3/h8-10,15-17H,11-14H2,1-7H3,(H,29,32).
What are the key properties of tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate?
tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate has a molecular weight of 480.61 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3,5-dimethylbenzoyl)-4-[(3-methoxy-2-methylbenzoyl)amino]piperidine-1-carboxylate is sourced from PubChem (CID 59713394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).