C20H27NO7S — CID 58423641
tert-butyl 5-methoxy-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 58423641) has the molecular formula C20H27NO7S and a molecular weight of 425.50 g/mol. Its IUPAC name is tert-butyl 5-methoxy-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 5-methoxy-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 58423641 |
| Molecular Formula | C20H27NO7S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | tert-butyl 5-methoxy-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | COc1cccc2c1C(OS(C)(=O)=O)=CC1(CCN(C(=O)OC(C)(C)C)CC1)O2 |
| InChI | InChI=1S/C20H27NO7S/c1-19(2,3)27-18(22)21-11-9-20(10-12-21)13-16(28-29(5,23)24)17-14(25-4)7-6-8-15(17)26-20/h6-8,13H,9-12H2,1-5H3 |
| InChIKey | XMHACQWNNFBBHD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|