C25H26N2O3 — CID 59674376
tert-butyl 4-(3-isocyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 59674376) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl 4-(3-isocyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 4-(3-isocyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 59674376 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tert-butyl 4-(3-isocyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | [C-]#[N+]c1cccc(C2=CC3(CCN(C(=O)OC(C)(C)C)CC3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-24(2,3)30-23(28)27-14-12-25(13-15-27)17-21(18-8-7-9-19(16-18)26-4)20-10-5-6-11-22(20)29-25/h5-11,16-17H,12-15H2,1-3H3 |
| InChIKey | FBHSMCNVQXDPMF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|