C32H42N2O4 — CID 143304383
tert-butyl 4-[4-[3-[butyl(ethyl)amino]oxiran-2-yl]phenyl]spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 143304383) has the molecular formula C32H42N2O4 and a molecular weight of 518.70 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-[butyl(ethyl)amino]oxiran-2-yl]phenyl]spiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-[butyl(ethyl)amino]oxiran-2-yl]phenyl]spiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 143304383 |
| Molecular Formula | C32H42N2O4 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | tert-butyl 4-[4-[3-[butyl(ethyl)amino]oxiran-2-yl]phenyl]spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCN(CC)C1OC1c1ccc(C2=CC3(CCN(C(=O)OC(C)(C)C)CC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C32H42N2O4/c1-6-8-19-33(7-2)29-28(36-29)24-15-13-23(14-16-24)26-22-32(37-27-12-10-9-11-25(26)27)17-20-34(21-18-32)30(35)38-31(3,4)5/h9-16,22,28-29H,6-8,17-21H2,1-5H3 |
| InChIKey | RANHGPFEPGNUQE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 54.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|