C30H35F3N2O7S — CID 59674616
tert-butyl 4-[4-(diethylcarbamoyl)phenyl]-6-(trifluoromethylsulfonyloxy)spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 59674616) has the molecular formula C30H35F3N2O7S and a molecular weight of 624.68 g/mol. Its IUPAC name is tert-butyl 4-[4-(diethylcarbamoyl)phenyl]-6-(trifluoromethylsulfonyloxy)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 4-[4-(diethylcarbamoyl)phenyl]-6-(trifluoromethylsulfonyloxy)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 59674616 |
| Molecular Formula | C30H35F3N2O7S |
| Molecular Weight | 624.68 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | tert-butyl 4-[4-(diethylcarbamoyl)phenyl]-6-(trifluoromethylsulfonyloxy)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC3(CCN(C(=O)OC(C)(C)C)CC3)Oc3ccc(OS(=O)(=O)C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C30H35F3N2O7S/c1-6-34(7-2)26(36)21-10-8-20(9-11-21)24-19-29(14-16-35(17-15-29)27(37)41-28(3,4)5)40-25-13-12-22(18-23(24)25)42-43(38,39)30(31,32)33/h8-13,18-19H,6-7,14-17H2,1-5H3 |
| InChIKey | LJUSZLMWHGTFCZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|