C57H72B46N4O9 — CID 158270527
CID 158270527 (PubChem CID 158270527) has the molecular formula C57H72B46N4O9 and a molecular weight of 1454.57 g/mol.
| Compound Name | CID 158270527 |
|---|---|
| PubChem CID | 158270527 |
| Molecular Formula | C57H72B46N4O9 |
| Molecular Weight | 1454.57 g/mol |
| Exact Mass | 1462.96 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC3(CCCN(C(=O)OC(C)(C)C)CC3)Oc3ccc(OCOC)cc32)cc1.CCN(CC)C(=O)c1ccc(C2=CC3(CCCNCC3)Oc3ccc(O)cc32)cc1.[B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C32H42N2O6.C25H30N2O3.B46/c1-7-33(8-2)29(35)24-12-10-23(11-13-24)27-21-32(39-28-15-14-25(20-26(27)28)38-22-37-6)16-9-18-34(19-17-32)30(36)40-31(3,4)5;1-3-27(4-2)24(29)19-8-6-18(7-9-19)22-17-25(12-5-14-26-15-13-25)30-23-11-10-20(28)16-21(22)23;1-25(2)37(26(3)4)43(38(27(5)6)28(7)8)46(44(39(29(9)10)30(11)12)40(31(13)14)32(15)16)45(41(33(17)18)34(19)20)42(35(21)22)36(23)24/h10-15,20-21H,7-9,16-19,22H2,1-6H3;6-11,16-17,26,28H,3-5,12-15H2,1-2H3; |
| InChIKey | HZOPNCFINMIOAI-UHFFFAOYSA-N |
| XLogP | -7.17 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 116 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1454.57 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|