C27H35N3O3 — CID 143304509
4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-carboxamide;ethane (PubChem CID 143304509) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-carboxamide;ethane.
| Compound Name | 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-carboxamide;ethane |
|---|---|
| PubChem CID | 143304509 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-carboxamide;ethane |
| SMILES | CC.CCN(CC)C(=O)c1ccc(C2=CC3(CCNCC3)Oc3ccc(C(N)=O)cc32)cc1 |
| InChI | InChI=1S/C25H29N3O3.C2H6/c1-3-28(4-2)24(30)18-7-5-17(6-8-18)21-16-25(11-13-27-14-12-25)31-22-10-9-19(23(26)29)15-20(21)22;1-2/h5-10,15-16,27H,3-4,11-14H2,1-2H3,(H2,26,29);1-2H3 |
| InChIKey | RHVNDFIVIWHPQR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |