C24H28N2O4S — CID 66696440
4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-sulfinic acid (PubChem CID 66696440) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-sulfinic acid.
| Compound Name | 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-sulfinic acid |
|---|---|
| PubChem CID | 66696440 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[4-(diethylcarbamoyl)phenyl]spiro[chromene-2,4'-piperidine]-6-sulfinic acid |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC3(CCNCC3)Oc3ccc(S(=O)O)cc32)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-3-26(4-2)23(27)18-7-5-17(6-8-18)21-16-24(11-13-25-14-12-24)30-22-10-9-19(31(28)29)15-20(21)22/h5-10,15-16,25H,3-4,11-14H2,1-2H3,(H,28,29) |
| InChIKey | YXDQNASGBWOATM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|