C31H40N2O3 — CID 58423588
N,N-diethyl-4-(6-heptanoylspiro[chromene-2,4'-piperidine]-4-yl)benzamide (PubChem CID 58423588) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is N,N-diethyl-4-(6-heptanoylspiro[chromene-2,4'-piperidine]-4-yl)benzamide.
| Compound Name | N,N-diethyl-4-(6-heptanoylspiro[chromene-2,4'-piperidine]-4-yl)benzamide |
|---|---|
| PubChem CID | 58423588 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | N,N-diethyl-4-(6-heptanoylspiro[chromene-2,4'-piperidine]-4-yl)benzamide |
| SMILES | CCCCCCC(=O)c1ccc2c(c1)C(c1ccc(C(=O)N(CC)CC)cc1)=CC1(CCNCC1)O2 |
| InChI | InChI=1S/C31H40N2O3/c1-4-7-8-9-10-28(34)25-15-16-29-26(21-25)27(22-31(36-29)17-19-32-20-18-31)23-11-13-24(14-12-23)30(35)33(5-2)6-3/h11-16,21-22,32H,4-10,17-20H2,1-3H3 |
| InChIKey | BDPTYTWYXKWSFF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|