C27H40BNO4 — CID 143642488
tert-butyl 5-ethyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 143642488) has the molecular formula C27H40BNO4 and a molecular weight of 453.43 g/mol. Its IUPAC name is tert-butyl 5-ethyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 5-ethyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 143642488 |
| Molecular Formula | C27H40BNO4 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | tert-butyl 5-ethyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCc1cccc2c1C(B1CC(C)(C)C(C)(C)O1)=CC1(CCN(C(=O)OC(C)(C)C)CC1)O2 |
| InChI | InChI=1S/C27H40BNO4/c1-9-19-11-10-12-21-22(19)20(28-18-25(5,6)26(7,8)33-28)17-27(31-21)13-15-29(16-14-27)23(30)32-24(2,3)4/h10-12,17H,9,13-16,18H2,1-8H3 |
| InChIKey | ARZAZCWPDCTNPN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|