C38H48BBrF3N5O6 — CID 123992323
7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 123992323) has the molecular formula C38H48BBrF3N5O6 and a molecular weight of 818.54 g/mol. Its IUPAC name is 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 123992323 |
| Molecular Formula | C38H48BBrF3N5O6 |
| Molecular Weight | 818.54 g/mol |
| Exact Mass | 817.28 |
| IUPAC Name | 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C=C(B3OC(C)(C)C(C)(C)O3)c3ccccc3O2)CC1.O=C(CCCCCn1nnc(-c2ccc(Br)cc2)n1)C(F)(F)F |
| InChI | InChI=1S/C24H34BNO5.C14H14BrF3N4O/c1-21(2,3)29-20(27)26-14-12-24(13-15-26)16-18(17-10-8-9-11-19(17)28-24)25-30-22(4,5)23(6,7)31-25;15-11-7-5-10(6-8-11)13-19-21-22(20-13)9-3-1-2-4-12(23)14(16,17)18/h8-11,16H,12-15H2,1-7H3;5-8H,1-4,9H2 |
| InChIKey | QQMVWWCZGJYZOJ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.54 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|