C14H14BrF3N4O — CID 58423652
7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one (PubChem CID 58423652) has the molecular formula C14H14BrF3N4O and a molecular weight of 391.19 g/mol. Its IUPAC name is 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one.
| Compound Name | 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one |
|---|---|
| PubChem CID | 58423652 |
| Molecular Formula | C14H14BrF3N4O |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 7-[5-(4-bromophenyl)tetrazol-2-yl]-1,1,1-trifluoroheptan-2-one |
| SMILES | O=C(CCCCCn1nnc(-c2ccc(Br)cc2)n1)C(F)(F)F |
| InChI | InChI=1S/C14H14BrF3N4O/c15-11-7-5-10(6-8-11)13-19-21-22(20-13)9-3-1-2-4-12(23)14(16,17)18/h5-8H,1-4,9H2 |
| InChIKey | LEFFMROZYRXCOB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|