About ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate
ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate (PubChem CID 59674640) has the molecular formula C26H29N5O3
and a molecular weight of 459.55 g/mol. Its IUPAC name is ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate |
| PubChem CID | 59674640 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate |
| SMILES | CCOC(=O)CCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C26H29N5O3/c1-2-33-24(32)8-5-17-31-29-25(28-30-31)20-11-9-19(10-12-20)22-18-26(13-15-27-16-14-26)34-23-7-4-3-6-21(22)23/h3-4,6-7,9-12,18,27H,2,5,8,13-17H2,1H3 |
| InChIKey | NTXBNOSZDWJGAA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate?
The IUPAC name of ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate (CID 59674640) is ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate.
What is the SMILES notation for ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate?
The canonical SMILES for ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate is CCOC(=O)CCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1.
What is the InChIKey of ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate?
The InChIKey is NTXBNOSZDWJGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5O3/c1-2-33-24(32)8-5-17-31-29-25(28-30-31)20-11-9-19(10-12-20)22-18-26(13-15-27-16-14-26)34-23-7-4-3-6-21(22)23/h3-4,6-7,9-12,18,27H,2,5,8,13-17H2,1H3.
What are the key properties of ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate?
ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate has a molecular weight of 459.55 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoate is sourced from PubChem (CID 59674640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).