C22H25N5O — CID 143304248
ethane;4-[4-(2H-tetrazol-5-yl)phenyl]spiro[chromene-2,4'-piperidine] (PubChem CID 143304248) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is ethane;4-[4-(2H-tetrazol-5-yl)phenyl]spiro[chromene-2,4'-piperidine].
| Compound Name | ethane;4-[4-(2H-tetrazol-5-yl)phenyl]spiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 143304248 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | ethane;4-[4-(2H-tetrazol-5-yl)phenyl]spiro[chromene-2,4'-piperidine] |
| SMILES | C1=C(c2ccc(-c3nn[nH]n3)cc2)c2ccccc2OC12CCNCC2.CC |
| InChI | InChI=1S/C20H19N5O.C2H6/c1-2-4-18-16(3-1)17(13-20(26-18)9-11-21-12-10-20)14-5-7-15(8-6-14)19-22-24-25-23-19;1-2/h1-8,13,21H,9-12H2,(H,22,23,24,25);1-2H3 |
| InChIKey | CKSZNSLECDEDTF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |