C19H20N2OS — CID 143029851
S-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)thiohydroxylamine (PubChem CID 143029851) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is S-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)thiohydroxylamine.
| Compound Name | S-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)thiohydroxylamine |
|---|---|
| PubChem CID | 143029851 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | S-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)thiohydroxylamine |
| SMILES | NSc1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2OS/c20-23-15-7-5-14(6-8-15)17-13-19(9-11-21-12-10-19)22-18-4-2-1-3-16(17)18/h1-8,13,21H,9-12,20H2 |
| InChIKey | SVBIBJZYGIDYAD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|