C20H23N5O — CID 143029921
N,N'-diamino-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide (PubChem CID 143029921) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is N,N'-diamino-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide.
| Compound Name | N,N'-diamino-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143029921 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N,N'-diamino-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
| SMILES | NN=C(NN)c1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C20H23N5O/c21-24-19(25-22)15-7-5-14(6-8-15)17-13-20(9-11-23-12-10-20)26-18-4-2-1-3-16(17)18/h1-8,13,23H,9-12,21-22H2,(H,24,25) |
| InChIKey | WMXQIVFEXQTHLO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|