C28H38N6O2 — CID 143304267
N-[6-[amino-[(Z)-[amino-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methylidene]amino]amino]hexyl]acetamide (PubChem CID 143304267) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[6-[amino-[(Z)-[amino-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methylidene]amino]amino]hexyl]acetamide.
| Compound Name | N-[6-[amino-[(Z)-[amino-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methylidene]amino]amino]hexyl]acetamide |
|---|---|
| PubChem CID | 143304267 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | N-[6-[amino-[(Z)-[amino-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methylidene]amino]amino]hexyl]acetamide |
| SMILES | CC(=O)NCCCCCCN(N)/N=C(\N)c1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C28H38N6O2/c1-21(35)32-16-6-2-3-7-19-34(30)33-27(29)23-12-10-22(11-13-23)25-20-28(14-17-31-18-15-28)36-26-9-5-4-8-24(25)26/h4-5,8-13,20,31H,2-3,6-7,14-19,30H2,1H3,(H2,29,33)(H,32,35) |
| InChIKey | CMQSNXQMHAQAPK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|