C25H34N6O2S — CID 143304180
N'-[amino-[4-(methanesulfinamido)butyl]amino]-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide (PubChem CID 143304180) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N'-[amino-[4-(methanesulfinamido)butyl]amino]-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide.
| Compound Name | N'-[amino-[4-(methanesulfinamido)butyl]amino]-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143304180 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N'-[amino-[4-(methanesulfinamido)butyl]amino]-4-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
| SMILES | CS(=O)NCCCCN(N)/N=C(\N)c1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C25H34N6O2S/c1-34(32)29-14-4-5-17-31(27)30-24(26)20-10-8-19(9-11-20)22-18-25(12-15-28-16-13-25)33-23-7-3-2-6-21(22)23/h2-3,6-11,18,28-29H,4-5,12-17,27H2,1H3,(H2,26,30) |
| InChIKey | XJWWBMMZNRWFQU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|