C25H30N4O — CID 143642783
(4-methylpiperazin-1-yl)-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methanimine (PubChem CID 143642783) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methanimine.
| Compound Name | (4-methylpiperazin-1-yl)-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 143642783 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)methanimine |
| SMILES | [H]/N=C(/c1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H30N4O/c1-28-14-16-29(17-15-28)24(26)20-8-6-19(7-9-20)22-18-25(10-12-27-13-11-25)30-23-5-3-2-4-21(22)23/h2-9,18,26-27H,10-17H2,1H3/b26-24- |
| InChIKey | LKTQFAJFNINURY-LCUIJRPUSA-N |
| XLogP | 3.21 |
| TPSA | 51.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|