C23H29N3O2 — CID 143642631
ethane;4-(5-methoxyspiro[chromene-2,4'-piperidine]-4-yl)benzenecarboximidamide (PubChem CID 143642631) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is ethane;4-(5-methoxyspiro[chromene-2,4'-piperidine]-4-yl)benzenecarboximidamide.
| Compound Name | ethane;4-(5-methoxyspiro[chromene-2,4'-piperidine]-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 143642631 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | ethane;4-(5-methoxyspiro[chromene-2,4'-piperidine]-4-yl)benzenecarboximidamide |
| SMILES | CC.[H]/N=C(\N)c1ccc(C2=CC3(CCNCC3)Oc3cccc(OC)c32)cc1 |
| InChI | InChI=1S/C21H23N3O2.C2H6/c1-25-17-3-2-4-18-19(17)16(13-21(26-18)9-11-24-12-10-21)14-5-7-15(8-6-14)20(22)23;1-2/h2-8,13,24H,9-12H2,1H3,(H3,22,23);1-2H3 |
| InChIKey | JHJMXKXATRRAIE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|