C22H22N2O2 — CID 143642463
4-[4-[1-(methylideneamino)ethenyl]phenyl]spiro[chromene-2,4'-piperidine]-5-ol (PubChem CID 143642463) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[4-[1-(methylideneamino)ethenyl]phenyl]spiro[chromene-2,4'-piperidine]-5-ol.
| Compound Name | 4-[4-[1-(methylideneamino)ethenyl]phenyl]spiro[chromene-2,4'-piperidine]-5-ol |
|---|---|
| PubChem CID | 143642463 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[4-[1-(methylideneamino)ethenyl]phenyl]spiro[chromene-2,4'-piperidine]-5-ol |
| SMILES | C=NC(=C)c1ccc(C2=CC3(CCNCC3)Oc3cccc(O)c32)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-15(23-2)16-6-8-17(9-7-16)18-14-22(10-12-24-13-11-22)26-20-5-3-4-19(25)21(18)20/h3-9,14,24-25H,1-2,10-13H2 |
| InChIKey | YHOHJUNLKKNONL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|