C20H21N5O — CID 143029810
N-hydrazinylidene-3-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide (PubChem CID 143029810) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-hydrazinylidene-3-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide.
| Compound Name | N-hydrazinylidene-3-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143029810 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-hydrazinylidene-3-spiro[chromene-2,4'-piperidine]-4-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1cccc(C2=CC3(CCNCC3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C20H21N5O/c21-19(24-25-22)15-5-3-4-14(12-15)17-13-20(8-10-23-11-9-20)26-18-7-2-1-6-16(17)18/h1-7,12-13,23H,8-11H2,(H3,21,22,24) |
| InChIKey | CGXOZVRJYLREIY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|