C20H22N2O — CID 143642595
4-(1'-methylspiro[chromene-2,4'-piperidine]-4-yl)aniline (PubChem CID 143642595) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(1'-methylspiro[chromene-2,4'-piperidine]-4-yl)aniline.
| Compound Name | 4-(1'-methylspiro[chromene-2,4'-piperidine]-4-yl)aniline |
|---|---|
| PubChem CID | 143642595 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-(1'-methylspiro[chromene-2,4'-piperidine]-4-yl)aniline |
| SMILES | CN1CCC2(C=C(c3ccc(N)cc3)c3ccccc3O2)CC1 |
| InChI | InChI=1S/C20H22N2O/c1-22-12-10-20(11-13-22)14-18(15-6-8-16(21)9-7-15)17-4-2-3-5-19(17)23-20/h2-9,14H,10-13,21H2,1H3 |
| InChIKey | RXLUWEJCYJJISE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|