C28H34IN5O — CID 143642670
4-[4-[2-(8-iodooctyl)tetrazol-5-yl]phenyl]spiro[chromene-2,4'-piperidine] (PubChem CID 143642670) has the molecular formula C28H34IN5O and a molecular weight of 583.52 g/mol. Its IUPAC name is 4-[4-[2-(8-iodooctyl)tetrazol-5-yl]phenyl]spiro[chromene-2,4'-piperidine].
| Compound Name | 4-[4-[2-(8-iodooctyl)tetrazol-5-yl]phenyl]spiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 143642670 |
| Molecular Formula | C28H34IN5O |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 4-[4-[2-(8-iodooctyl)tetrazol-5-yl]phenyl]spiro[chromene-2,4'-piperidine] |
| SMILES | ICCCCCCCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C28H34IN5O/c29-17-7-3-1-2-4-8-20-34-32-27(31-33-34)23-13-11-22(12-14-23)25-21-28(15-18-30-19-16-28)35-26-10-6-5-9-24(25)26/h5-6,9-14,21,30H,1-4,7-8,15-20H2 |
| InChIKey | GUKOBCYXTJPLLG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|