C16H16N2OS — CID 59674547
4-(1,3-thiazol-2-yl)spiro[chromene-2,4'-piperidine] (PubChem CID 59674547) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)spiro[chromene-2,4'-piperidine].
| Compound Name | 4-(1,3-thiazol-2-yl)spiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 59674547 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)spiro[chromene-2,4'-piperidine] |
| SMILES | C1=C(c2nccs2)c2ccccc2OC12CCNCC2 |
| InChI | InChI=1S/C16H16N2OS/c1-2-4-14-12(3-1)13(15-18-9-10-20-15)11-16(19-14)5-7-17-8-6-16/h1-4,9-11,17H,5-8H2 |
| InChIKey | RXZFHYPOABBPFO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |