C13H7F3N2OS — CID 134867970
3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-imine (PubChem CID 134867970) has the molecular formula C13H7F3N2OS and a molecular weight of 296.27 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-imine.
| Compound Name | 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-imine |
|---|---|
| PubChem CID | 134867970 |
| Molecular Formula | C13H7F3N2OS |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-imine |
| SMILES | [H]/N=c1\oc2ccccc2c(C(F)(F)F)c1-c1nccs1 |
| InChI | InChI=1S/C13H7F3N2OS/c14-13(15,16)10-7-3-1-2-4-8(7)19-11(17)9(10)12-18-5-6-20-12/h1-6,17H/b17-11- |
| InChIKey | PVUNNKYSXBMCAS-BOPFTXTBSA-N |
| XLogP | 4.05 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |