C13H6F3NO2S — CID 134912142
3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one (PubChem CID 134912142) has the molecular formula C13H6F3NO2S and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 134912142 |
| Molecular Formula | C13H6F3NO2S |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1oc2ccccc2c(C(F)(F)F)c1-c1nccs1 |
| InChI | InChI=1S/C13H6F3NO2S/c14-13(15,16)10-7-3-1-2-4-8(7)19-12(18)9(10)11-17-5-6-20-11/h1-6H |
| InChIKey | OAVCEGIGSAWGNT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|