C12H7NO2S — CID 141217144
3-(1,3-thiazol-5-yl)chromen-2-one (PubChem CID 141217144) has the molecular formula C12H7NO2S and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-yl)chromen-2-one.
| Compound Name | 3-(1,3-thiazol-5-yl)chromen-2-one |
|---|---|
| PubChem CID | 141217144 |
| Molecular Formula | C12H7NO2S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 3-(1,3-thiazol-5-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cncs1 |
| InChI | InChI=1S/C12H7NO2S/c14-12-9(11-6-13-7-16-11)5-8-3-1-2-4-10(8)15-12/h1-7H |
| InChIKey | DCROIVWSLUXRRN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|