C17H15F3N2O2S — CID 134911772
7-(diethylamino)-3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one (PubChem CID 134911772) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is 7-(diethylamino)-3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-(diethylamino)-3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 134911772 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 7-(diethylamino)-3-(1,3-thiazol-2-yl)-4-(trifluoromethyl)chromen-2-one |
| SMILES | CCN(CC)c1ccc2c(C(F)(F)F)c(-c3nccs3)c(=O)oc2c1 |
| InChI | InChI=1S/C17H15F3N2O2S/c1-3-22(4-2)10-5-6-11-12(9-10)24-16(23)13(14(11)17(18,19)20)15-21-7-8-25-15/h5-9H,3-4H2,1-2H3 |
| InChIKey | LVCNOXWTHLKHBO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|