C19H13FN2O2S — CID 166175216
3-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-6-fluorochromen-2-one (PubChem CID 166175216) has the molecular formula C19H13FN2O2S and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-6-fluorochromen-2-one.
| Compound Name | 3-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-6-fluorochromen-2-one |
|---|---|
| PubChem CID | 166175216 |
| Molecular Formula | C19H13FN2O2S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-6-fluorochromen-2-one |
| SMILES | CCc1cc(-c2nc(-c3cc4cc(F)ccc4oc3=O)cs2)ccn1 |
| InChI | InChI=1S/C19H13FN2O2S/c1-2-14-8-11(5-6-21-14)18-22-16(10-25-18)15-9-12-7-13(20)3-4-17(12)24-19(15)23/h3-10H,2H2,1H3 |
| InChIKey | JUKAYMLGZKMAFY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|