C24H20N2O2S — CID 25012734
[4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl] benzoate (PubChem CID 25012734) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is [4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl] benzoate.
| Compound Name | [4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 25012734 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [4-[2-(2-propyl-4-pyridinyl)-1,3-thiazol-4-yl]phenyl] benzoate |
| SMILES | CCCc1cc(-c2nc(-c3ccc(OC(=O)c4ccccc4)cc3)cs2)ccn1 |
| InChI | InChI=1S/C24H20N2O2S/c1-2-6-20-15-19(13-14-25-20)23-26-22(16-29-23)17-9-11-21(12-10-17)28-24(27)18-7-4-3-5-8-18/h3-5,7-16H,2,6H2,1H3 |
| InChIKey | UTQIDXTXWUQIBV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|