C16H10F2N2O2S — CID 3506632
(5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) 2,4-difluorobenzoate (PubChem CID 3506632) has the molecular formula C16H10F2N2O2S and a molecular weight of 332.33 g/mol. Its IUPAC name is (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) 2,4-difluorobenzoate.
| Compound Name | (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 3506632 |
| Molecular Formula | C16H10F2N2O2S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) 2,4-difluorobenzoate |
| SMILES | Cc1sc(-c2ccncc2)nc1OC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H10F2N2O2S/c1-9-14(20-15(23-9)10-4-6-19-7-5-10)22-16(21)12-3-2-11(17)8-13(12)18/h2-8H,1H3 |
| InChIKey | JSDQNCFJXXRFCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |