C10H6F3NOS — CID 66694987
2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole (PubChem CID 66694987) has the molecular formula C10H6F3NOS and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66694987 |
| Molecular Formula | C10H6F3NOS |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)Oc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C10H6F3NOS/c11-10(12,13)15-8-3-1-7(2-4-8)9-14-5-6-16-9/h1-6H |
| InChIKey | ROCAIAVCIBSQPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |