C10H9NOS — CID 4034644
4-(4-methoxyphenyl)-1,3-thiazole (PubChem CID 4034644) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(4-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 4034644 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C10H9NOS/c1-12-9-4-2-8(3-5-9)10-6-13-7-11-10/h2-7H,1H3 |
| InChIKey | VOWXAMZJYPLGFZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |