C32H45BN2O11S — CID 123780525
tert-butyl 5-(methoxymethoxy)-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate;[4-(diethylcarbamoyl)phenyl]boronic acid (PubChem CID 123780525) has the molecular formula C32H45BN2O11S and a molecular weight of 676.59 g/mol. Its IUPAC name is tert-butyl 5-(methoxymethoxy)-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate;[4-(diethylcarbamoyl)phenyl]boronic acid.
| Compound Name | tert-butyl 5-(methoxymethoxy)-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate;[4-(diethylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 123780525 |
| Molecular Formula | C32H45BN2O11S |
| Molecular Weight | 676.59 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | tert-butyl 5-(methoxymethoxy)-4-methylsulfonyloxyspiro[chromene-2,4'-piperidine]-1'-carboxylate;[4-(diethylcarbamoyl)phenyl]boronic acid |
| SMILES | CCN(CC)C(=O)c1ccc(B(O)O)cc1.COCOc1cccc2c1C(OS(C)(=O)=O)=CC1(CCN(C(=O)OC(C)(C)C)CC1)O2 |
| InChI | InChI=1S/C21H29NO8S.C11H16BNO3/c1-20(2,3)29-19(23)22-11-9-21(10-12-22)13-17(30-31(5,24)25)18-15(27-14-26-4)7-6-8-16(18)28-21;1-3-13(4-2)11(14)9-5-7-10(8-6-9)12(15)16/h6-8,13H,9-12,14H2,1-5H3;5-8,15-16H,3-4H2,1-2H3 |
| InChIKey | YXALXIPGECLXNZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 161.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|