C39H52N2O8Si — CID 67604111
tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-[4-(3,4-dimethoxyphenyl)benzoyl]oxyazepane-1-carboxylate (PubChem CID 67604111) has the molecular formula C39H52N2O8Si and a molecular weight of 704.94 g/mol. Its IUPAC name is tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-[4-(3,4-dimethoxyphenyl)benzoyl]oxyazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-[4-(3,4-dimethoxyphenyl)benzoyl]oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 67604111 |
| Molecular Formula | C39H52N2O8Si |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.35 |
| IUPAC Name | tert-butyl 4-[[2-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]-4-[4-(3,4-dimethoxyphenyl)benzoyl]oxyazepane-1-carboxylate |
| SMILES | COc1ccc(-c2ccc(C(=O)OC3(NC(=O)c4ccccc4O[Si](C)(C)C(C)(C)C)CCCN(C(=O)OC(C)(C)C)CC3)cc2)cc1OC |
| InChI | InChI=1S/C39H52N2O8Si/c1-37(2,3)48-36(44)41-24-13-22-39(23-25-41,40-34(42)30-14-11-12-15-31(30)49-50(9,10)38(4,5)6)47-35(43)28-18-16-27(17-19-28)29-20-21-32(45-7)33(26-29)46-8/h11-12,14-21,26H,13,22-25H2,1-10H3,(H,40,42) |
| InChIKey | BHUWQFUAWNTSFQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|