C32H35N3O8 — CID 67604519
tert-butyl (3R,4R)-4-benzoyloxy-4-[(2-hydroxybenzoyl)amino]-3-[(4-hydroxybenzoyl)amino]azepane-1-carboxylate (PubChem CID 67604519) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-benzoyloxy-4-[(2-hydroxybenzoyl)amino]-3-[(4-hydroxybenzoyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-benzoyloxy-4-[(2-hydroxybenzoyl)amino]-3-[(4-hydroxybenzoyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 67604519 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | tert-butyl (3R,4R)-4-benzoyloxy-4-[(2-hydroxybenzoyl)amino]-3-[(4-hydroxybenzoyl)amino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](NC(=O)c2ccccc2O)(OC(=O)c2ccccc2)[C@H](NC(=O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C32H35N3O8/c1-31(2,3)43-30(41)35-19-9-18-32(42-29(40)22-10-5-4-6-11-22,34-28(39)24-12-7-8-13-25(24)37)26(20-35)33-27(38)21-14-16-23(36)17-15-21/h4-8,10-17,26,36-37H,9,18-20H2,1-3H3,(H,33,38)(H,34,39)/t26-,32-/m1/s1 |
| InChIKey | DYEHYQMWHIAARN-HVIPQOSHSA-N |
| XLogP | 4.21 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|